InCHi String:
InChI=1S/C7H7NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1-3H,4H2,(H,8,11)(H,9,10)
canonical and isomeric SMILES: C1=COC(=C1)C(=O)NCC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME2-(furan-2-carbonylamino)acetic acid
PUBCHEM iupac TRADITIONAL NAME2-(2-furoylamino)acetic acid
PUBCHEM iupac CAS NAME2-[[2-furyl(oxo)methyl]amino]acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(furan-2-ylcarbonylamino)ethanoic acid
PubChem Substance (SID):
111677758 24865428 164573PubChem Compound (CID):
21863KEGG: Compound ID n/a
CAS Registry IDs: 5657-19-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 407143_ALDRICH
Beilstein Handbook Reference 4-18-00-03955
ChemIDplus 005657192
NIST 1853106001
MMCD cq_10620
MDL MFCD00030606
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.