InCHi String:
InChI=1S/C4H7N3S/c1-2-3-6-7-4(5)8-3/h2H2,1H3,(H2,5,7)
isomeric and canonical SMILES: CCC1=NN=C(S1)N
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic5-ethyl-1,3,4-thiadiazol-2-amine
PubChem Substance (SID):
85164999 169177PubChem Compound (CID):
26444KEGG: Compound ID n/a
CAS Registry IDs: 14068-53-2
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
EINECS 237-921-4
Beilstein Handbook Reference 4-27-00-08073
NSC 75711
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.