InCHi String:
InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H,10,11)
canonical and isomeric SMILES: COC1=CC=CC(=C1N)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME2-amino-3-methoxybenzoic acid
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME2-amino-3-methoxy-benzoic acid
PUBCHEM iupac SYSTEMATIC NAME2-azanyl-3-methoxy-benzoic acid
PubChem Substance (SID):
111677830 8125 14717668PubChem Compound (CID):
255720KEGG: Compound ID
C05831CAS Registry IDs: 3177-80-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 340103_ALDRICH
ChEBI CHEBI:27440 NMRShiftDB 20039243
ChemDB 6684662
DTP/NCI 81443
MMCD cq_03275
MDL MFCD00075178
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.