InCHi String:
InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)
canonical and isomeric SMILES: CC(C)CC(C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac CAS NAME2-hydroxy-4-methylpentanoic acid
PUBCHEM iupac TRADITIONAL NAME2-hydroxy-4-methyl-valeric acid
PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME2-hydroxy-4-methyl-pentanoic acid
PubChem Substance (SID):
85165138 4617518 10351521PubChem Compound (CID):
92779KEGG: Compound ID n/a
CAS Registry IDs: 54641-21-3 10303-64-7 26671-68-1 498-36-2
PDB Chemical Component
1LU OLEMiscellaneous Databases and IDs:
ChemIDplus 000498362
ChemSpider 83753
NIST 3673653695
DiscoveryGate 92779
EINECS 207-860-8
Sigma-Aldrich 219819_ALDRICH
ChemDB 6047663
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.