InCHi String:
InChI=1S/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H
canonical and isomeric SMILES: C1=C(C(=CC(=C1Cl)O)Cl)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME2,5-dichlorobenzene-1,4-diol
PUBCHEM iupac TRADITIONAL NAME2,5-dichlorohydroquinone
PubChem Substance (SID):
111677799 77705475 24438446PubChem Compound (CID):
65KEGG: Compound ID n/a
CAS Registry IDs: 824-69-1
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 480487_ALDRICH
ChemSpider 64
ZINC ZINC00403237
NextBio 65
UM-BBD c0364
NIST Chemistry WebBook 687497401
MMCD cq_03775
MDL MFCD00041749
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.