InCHi String:
InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13)
canonical and isomeric SMILES: C1=C(C(=CC(=C1Cl)Cl)Cl)OCC(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME2-(2,4,5-trichlorophenoxy)acetic acid
PUBCHEM iupac SYSTEMATIC NAME2-(2,4,5-trichlorophenoxy)ethanoic acid
PubChem Substance (SID):
111677779 35239411 9311PubChem Compound (CID):
1480KEGG: Compound ID
C07100CAS Registry IDs: 93-76-5
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich T5785_SIGMA
EPA DSSTox 30098
ChemSpider 13847721
ChEBI CHEBI:27903 NMRShiftDB 20041096
NIST 3521570443
MMCD cq_04173
MDL MFCD00004301
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.