InCHi String:
InChI=1S/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14)
canonical and isomeric SMILES: C1=CC=C2C(=C1)C=CC(=C2O)C(=O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME1-hydroxynaphthalene-2-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME1-hydroxy-2-naphthoic acid
PUBCHEM iupac CAS NAME1-hydroxy-2-naphthalenecarboxylic acid
PubChem Substance (SID):
111677827 10431660 607482PubChem Compound (CID):
6844KEGG: Compound ID
C03203CAS Registry IDs: 86-48-6
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 109630_ALDRICH
NMRShiftDB 20096906
NIAID 018042
ChemDB 4088390
NIST 863063989
MMCD cq_01930
MDL MFCD00003960
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.