InCHi String:
InChI=1S/C7H10NO3P/c8-7(12(9,10)11)6-4-2-1-3-5-6/h1-5,7H,8H2,(H2,9,10,11)
isomeric and canonical SMILES: C1=CC=C(C=C1)C(N)P(=O)(O)O
IUPAC: IUPAC traditional: IUPAC cas: IUPAC openeye: IUPAC systematic(amino-phenyl-methyl)phosphonic acid
PubChem Substance (SID):
85164994 675736PubChem Compound (CID):
98449KEGG: Compound ID n/a
CAS Registry IDs: 18108-22-0
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Beilstein Handbook Reference 4-07-00-00555
NSC 133874
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
