InCHi String:
InChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15)
canonical and isomeric SMILES: C1=CC=C2C(=C1)C(=CC(=C2O)C(=O)O)O
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME1,4-dihydroxynaphthalene-2-carboxylic acid
PUBCHEM iupac TRADITIONAL NAME1,4-dihydroxy-2-naphthoic acid
PUBCHEM iupac CAS NAME1,4-dihydroxy-2-naphthalenecarboxylic acid
PubChem Substance (SID):
111677826 5262447 57244111PubChem Compound (CID):
671KEGG: Compound ID
C03657CAS Registry IDs: 31519-22-9
PDB Chemical Component
DNAMiscellaneous Databases and IDs:
Sigma-Aldrich 281255_ALDRICH
ChEBI CHEBI:18094 EPA DSSTox 37784
ChemDB 4562741
NIST 501546681
MMCD cq_02168
MDL MFCD00010370
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.