InCHi String:
InChI=1S/C10H14O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,6,8-9H,4-5H2,1-2H3
canonical and isomeric SMILES: CC1(C2CC=C(C1C2)C=O)C
PUBCHEM iupac NAME: PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac SYSTEMATIC NAME7,7-dimethylbicyclo[3.1.1]hept-3-ene-4-carbaldehyde
PUBCHEM iupac CAS NAME7,7-dimethyl-4-bicyclo[3.1.1]hept-3-enecarboxaldehyde
PubChem Substance (SID):
85165315 24853054 10527497PubChem Compound (CID):
61130KEGG: Compound ID
C11939CAS Registry IDs: 564-94-3 57526-63-3 23727-16-4
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 218243_ALDRICH
LipidMAPS LMPR01020092
ChemIDplus 000564943
UM-BBD c0632
ChemSpider 11649942
EINECS 209-274-8
ChemDB 4581895
NIST Chemistry WebBook 298720437
DTP/NCI 54384
MMCD cq_08513
MDL MFCD00074768
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
