InCHi String:
InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-/m1/s1
canonical SMILES: CC1CCC(CC1O)C(=C)C
isomeric SMILES: C[C@@H]1CC[C@H](C[C@H]1O)C(=C)C
PUBCHEM iupac NAME(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol
PUBCHEM iupac TRADITIONAL NAME: PUBCHEM iupac OPENEYE NAME(1R,2R,5R)-5-isopropenyl-2-methyl-cyclohexan-1-ol
PUBCHEM iupac CAS NAME(1R,2R,5R)-5-isopropenyl-2-methyl-1-cyclohexanol
PUBCHEM iupac SYSTEMATIC NAME(1R,2R,5R)-2-methyl-5-prop-1-en-2-yl-cyclohexan-1-ol
PubChem Substance (SID):
85165314 50139448 36886533PubChem Compound (CID):
443163KEGG: Compound ID
C11396CAS Registry IDs: n/a
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 37278_FLUKA
ChEBI CHEBI:149 LipidMAPS LMPR01020079
ChemSpider 391435
MMCD cq_08034
MDL MFCD00210042
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.