InCHi String:
InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)
canonical and isomeric SMILES: C(CCCCCCCC(=O)O)CCCCCCCO
PUBCHEM iupac NAME: PUBCHEM iupac OPENEYE NAME: PUBCHEM iupac CAS NAME: PUBCHEM iupac SYSTEMATIC NAME16-hydroxyhexadecanoic acid
PUBCHEM iupac TRADITIONAL NAME16-hydroxypalmitic acid
PubChem Substance (SID):
111677837 24850642 7850148PubChem Compound (CID):
10466KEGG: Compound ID n/a
CAS Registry IDs: 506-13-8
PDB Chemical Component n/a
Miscellaneous Databases and IDs:
Sigma-Aldrich 177490_ALDRICH
ChEBI CHEBI:55328 EINECS 208-028-7
LipidMAPS LMFA01050051
ChemDB 5752896
ChemIDplus 000506138
NIST 2917536532
MMCD cq_10346
MDL MFCD00002750
Reference data were obtained primarily from the PubChem database.
Three dimensional molecular rendering uses Jmol.
